C22H19Cl3FN3O3S — CID 42657265
1-[3-[(4-chlorophenyl)sulfonylamino]propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea (PubChem CID 42657265) has the molecular formula C22H19Cl3FN3O3S and a molecular weight of 530.84 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)sulfonylamino]propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea.
| Compound Name | 1-[3-[(4-chlorophenyl)sulfonylamino]propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42657265 |
| Molecular Formula | C22H19Cl3FN3O3S |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)sulfonylamino]propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N(CCCNS(=O)(=O)c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19Cl3FN3O3S/c23-15-2-9-19(10-3-15)33(31,32)27-12-1-13-29(18-7-4-16(26)5-8-18)22(30)28-17-6-11-20(24)21(25)14-17/h2-11,14,27H,1,12-13H2,(H,28,30) |
| InChIKey | UJIIYHVBVFNGLS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|