C22H22FN3O3S — CID 42705478
1-(4-fluorophenyl)-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-phenylurea (PubChem CID 42705478) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-phenylurea.
| Compound Name | 1-(4-fluorophenyl)-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 42705478 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-(4-fluorophenyl)-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-phenylurea |
| SMILES | Cc1ccc(S(=O)(=O)NCCN(C(=O)Nc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H22FN3O3S/c1-17-7-13-21(14-8-17)30(28,29)24-15-16-26(20-11-9-18(23)10-12-20)22(27)25-19-5-3-2-4-6-19/h2-14,24H,15-16H2,1H3,(H,25,27) |
| InChIKey | VMDPSGSTBPXEMU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |