C28H26ClN3O4S — CID 42657933
1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1-(4-phenoxyphenyl)urea (PubChem CID 42657933) has the molecular formula C28H26ClN3O4S and a molecular weight of 536.05 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1-(4-phenoxyphenyl)urea.
| Compound Name | 1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42657933 |
| Molecular Formula | C28H26ClN3O4S |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1-(4-phenoxyphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N(CCNS(=O)(=O)c2ccc(Cl)cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26ClN3O4S/c1-21-7-11-23(12-8-21)31-28(33)32(20-19-30-37(34,35)27-17-9-22(29)10-18-27)24-13-15-26(16-14-24)36-25-5-3-2-4-6-25/h2-18,30H,19-20H2,1H3,(H,31,33) |
| InChIKey | NVGJDPBIKMKMDZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |