C30H30N4O3 — CID 4210938
3-(4-methylphenyl)-1-[2-[(4-methylphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea (PubChem CID 4210938) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[2-[(4-methylphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(4-methylphenyl)-1-[2-[(4-methylphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 4210938 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 3-(4-methylphenyl)-1-[2-[(4-methylphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCN(C(=O)Nc2ccc(C)cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O3/c1-22-8-12-24(13-9-22)32-29(35)31-20-21-34(30(36)33-25-14-10-23(2)11-15-25)26-16-18-28(19-17-26)37-27-6-4-3-5-7-27/h3-19H,20-21H2,1-2H3,(H,33,36)(H2,31,32,35) |
| InChIKey | DMKXOSHESLZRIK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |