C30H35N3O3 — CID 42725939
3-cyclopentyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]propanamide (PubChem CID 42725939) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-cyclopentyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]propanamide |
|---|---|
| PubChem CID | 42725939 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-cyclopentyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]propanamide |
| SMILES | Cc1ccc(NC(=O)N(CCNC(=O)CCC2CCCC2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-23-11-14-25(15-12-23)32-30(35)33(22-21-31-29(34)20-13-24-7-5-6-8-24)26-16-18-28(19-17-26)36-27-9-3-2-4-10-27/h2-4,9-12,14-19,24H,5-8,13,20-22H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | YLZQZVLPYJTANE-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |