C21H25NO2 — CID 2446291
3-cyclopentyl-N-[4-(3-methylphenoxy)phenyl]propanamide (PubChem CID 2446291) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-(3-methylphenoxy)phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[4-(3-methylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 2446291 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-cyclopentyl-N-[4-(3-methylphenoxy)phenyl]propanamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)CCC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C21H25NO2/c1-16-5-4-8-20(15-16)24-19-12-10-18(11-13-19)22-21(23)14-9-17-6-2-3-7-17/h4-5,8,10-13,15,17H,2-3,6-7,9,14H2,1H3,(H,22,23) |
| InChIKey | DLDQUZNGQCNGDT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |