C23H24N2O4 — CID 17342290
3-cyclohexyl-N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide (PubChem CID 17342290) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-cyclohexyl-N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide |
|---|---|
| PubChem CID | 17342290 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-cyclohexyl-N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1cccc(Oc2ccc3c(c2)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(12-9-15-5-2-1-3-6-15)24-16-7-4-8-17(13-16)29-18-10-11-19-20(14-18)23(28)25-22(19)27/h4,7-8,10-11,13-15H,1-3,5-6,9,12H2,(H,24,26)(H,25,27,28) |
| InChIKey | PNSFHTQMDZDDSA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|