C29H25Cl2N3O3 — CID 42726419
2,4-dichloro-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide (PubChem CID 42726419) has the molecular formula C29H25Cl2N3O3 and a molecular weight of 534.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide |
|---|---|
| PubChem CID | 42726419 |
| Molecular Formula | C29H25Cl2N3O3 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 2,4-dichloro-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)N(CCNC(=O)c2ccc(Cl)cc2Cl)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H25Cl2N3O3/c1-20-7-10-22(11-8-20)33-29(36)34(18-17-32-28(35)26-16-9-21(30)19-27(26)31)23-12-14-25(15-13-23)37-24-5-3-2-4-6-24/h2-16,19H,17-18H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | JQHBCFLGAAYESA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |