C28H23ClN4O5 — CID 42708263
N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-phenoxyanilino]ethyl]-3-nitrobenzamide (PubChem CID 42708263) has the molecular formula C28H23ClN4O5 and a molecular weight of 530.97 g/mol. Its IUPAC name is N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-phenoxyanilino]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-phenoxyanilino]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42708263 |
| Molecular Formula | C28H23ClN4O5 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-phenoxyanilino]ethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCN(C(=O)Nc1ccc(Cl)cc1)c1ccc(Oc2ccccc2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23ClN4O5/c29-21-9-11-22(12-10-21)31-28(35)32(18-17-30-27(34)20-5-4-6-24(19-20)33(36)37)23-13-15-26(16-14-23)38-25-7-2-1-3-8-25/h1-16,19H,17-18H2,(H,30,34)(H,31,35) |
| InChIKey | OFOXRBOKXDODQY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|