C26H21ClFN3O2 — CID 42705494
N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-fluoroanilino]ethyl]naphthalene-2-carboxamide (PubChem CID 42705494) has the molecular formula C26H21ClFN3O2 and a molecular weight of 461.92 g/mol. Its IUPAC name is N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-fluoroanilino]ethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-fluoroanilino]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 42705494 |
| Molecular Formula | C26H21ClFN3O2 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-4-fluoroanilino]ethyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCN(C(=O)Nc1ccc(Cl)cc1)c1ccc(F)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H21ClFN3O2/c27-21-7-11-23(12-8-21)30-26(33)31(24-13-9-22(28)10-14-24)16-15-29-25(32)20-6-5-18-3-1-2-4-19(18)17-20/h1-14,17H,15-16H2,(H,29,32)(H,30,33) |
| InChIKey | YWRWAUBCFJIJBX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |