C22H16Cl3FN2O2 — CID 42708642
3,4-dichloro-N-[2-(N-(4-chlorobenzoyl)-4-fluoroanilino)ethyl]benzamide (PubChem CID 42708642) has the molecular formula C22H16Cl3FN2O2 and a molecular weight of 465.74 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(N-(4-chlorobenzoyl)-4-fluoroanilino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(N-(4-chlorobenzoyl)-4-fluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 42708642 |
| Molecular Formula | C22H16Cl3FN2O2 |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 3,4-dichloro-N-[2-(N-(4-chlorobenzoyl)-4-fluoroanilino)ethyl]benzamide |
| SMILES | O=C(NCCN(C(=O)c1ccc(Cl)cc1)c1ccc(F)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl3FN2O2/c23-16-4-1-14(2-5-16)22(30)28(18-8-6-17(26)7-9-18)12-11-27-21(29)15-3-10-19(24)20(25)13-15/h1-10,13H,11-12H2,(H,27,29) |
| InChIKey | GNGHXWDLHVKDLE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |