C27H23ClFN3O2 — CID 42702747
N-[3-[N-[(3-chlorophenyl)carbamoyl]-4-fluoroanilino]propyl]naphthalene-1-carboxamide (PubChem CID 42702747) has the molecular formula C27H23ClFN3O2 and a molecular weight of 475.95 g/mol. Its IUPAC name is N-[3-[N-[(3-chlorophenyl)carbamoyl]-4-fluoroanilino]propyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-[N-[(3-chlorophenyl)carbamoyl]-4-fluoroanilino]propyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 42702747 |
| Molecular Formula | C27H23ClFN3O2 |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[3-[N-[(3-chlorophenyl)carbamoyl]-4-fluoroanilino]propyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCCCN(C(=O)Nc1cccc(Cl)c1)c1ccc(F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H23ClFN3O2/c28-20-8-4-9-22(18-20)31-27(34)32(23-14-12-21(29)13-15-23)17-5-16-30-26(33)25-11-3-7-19-6-1-2-10-24(19)25/h1-4,6-15,18H,5,16-17H2,(H,30,33)(H,31,34) |
| InChIKey | RVNCLVQOTMVCCV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|