C24H21ClF4N4O2 — CID 42702752
3-(3-chlorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea (PubChem CID 42702752) has the molecular formula C24H21ClF4N4O2 and a molecular weight of 508.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
|---|---|
| PubChem CID | 42702752 |
| Molecular Formula | C24H21ClF4N4O2 |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
| SMILES | O=C(NCCCN(C(=O)Nc1cccc(Cl)c1)c1ccc(F)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H21ClF4N4O2/c25-16-5-3-6-18(15-16)31-23(35)33(19-11-9-17(26)10-12-19)14-4-13-30-22(34)32-21-8-2-1-7-20(21)24(27,28)29/h1-3,5-12,15H,4,13-14H2,(H,31,35)(H2,30,32,34) |
| InChIKey | ASUFWWRGHWSGEE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|