C24H21F5N4O2 — CID 42705740
3-(2-fluorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea (PubChem CID 42705740) has the molecular formula C24H21F5N4O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea.
| Compound Name | 3-(2-fluorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
|---|---|
| PubChem CID | 42705740 |
| Molecular Formula | C24H21F5N4O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(4-fluorophenyl)-1-[3-[[2-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
| SMILES | O=C(NCCCN(C(=O)Nc1ccccc1F)c1ccc(F)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H21F5N4O2/c25-16-10-12-17(13-11-16)33(23(35)32-21-9-4-2-7-19(21)26)15-5-14-30-22(34)31-20-8-3-1-6-18(20)24(27,28)29/h1-4,6-13H,5,14-15H2,(H,32,35)(H2,30,31,34) |
| InChIKey | YGEDVWXVKYKSBU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|