C31H30F2N4O4 — CID 42707075
1-[3-[(2,4-difluorophenyl)carbamoylamino]propyl]-3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)urea (PubChem CID 42707075) has the molecular formula C31H30F2N4O4 and a molecular weight of 560.60 g/mol. Its IUPAC name is 1-[3-[(2,4-difluorophenyl)carbamoylamino]propyl]-3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)urea.
| Compound Name | 1-[3-[(2,4-difluorophenyl)carbamoylamino]propyl]-3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42707075 |
| Molecular Formula | C31H30F2N4O4 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 1-[3-[(2,4-difluorophenyl)carbamoylamino]propyl]-3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)N(CCCNC(=O)Nc2ccc(F)cc2F)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H30F2N4O4/c1-2-40-25-14-10-23(11-15-25)35-31(39)37(24-12-16-27(17-13-24)41-26-7-4-3-5-8-26)20-6-19-34-30(38)36-29-18-9-22(32)21-28(29)33/h3-5,7-18,21H,2,6,19-20H2,1H3,(H,35,39)(H2,34,36,38) |
| InChIKey | OLFBLCSTAZEOOU-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|