C25H25ClFN3O3 — CID 42707148
2-chloro-N-[2-[N-[(4-ethoxyphenyl)carbamoyl]-4-fluoroanilino]ethyl]-2-phenylacetamide (PubChem CID 42707148) has the molecular formula C25H25ClFN3O3 and a molecular weight of 469.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[N-[(4-ethoxyphenyl)carbamoyl]-4-fluoroanilino]ethyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[2-[N-[(4-ethoxyphenyl)carbamoyl]-4-fluoroanilino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42707148 |
| Molecular Formula | C25H25ClFN3O3 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-chloro-N-[2-[N-[(4-ethoxyphenyl)carbamoyl]-4-fluoroanilino]ethyl]-2-phenylacetamide |
| SMILES | CCOc1ccc(NC(=O)N(CCNC(=O)C(Cl)c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H25ClFN3O3/c1-2-33-22-14-10-20(11-15-22)29-25(32)30(21-12-8-19(27)9-13-21)17-16-28-24(31)23(26)18-6-4-3-5-7-18/h3-15,23H,2,16-17H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | IPTMXEPMPBQMSU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|