C24H23ClFN3O2 — CID 4661824
2-chloro-N-[2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethyl]-2-phenylacetamide (PubChem CID 4661824) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 4661824 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-chloro-N-[2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethyl]-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)N(CCNC(=O)C(Cl)c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H23ClFN3O2/c1-17-7-11-20(12-8-17)28-24(31)29(21-13-9-19(26)10-14-21)16-15-27-23(30)22(25)18-5-3-2-4-6-18/h2-14,22H,15-16H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | DVZPDYVGWACMMS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|