C16H19FN3O+ — CID 6941397
2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethylazanium (PubChem CID 6941397) has the molecular formula C16H19FN3O+ and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethylazanium.
| Compound Name | 2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethylazanium |
|---|---|
| PubChem CID | 6941397 |
| Molecular Formula | C16H19FN3O+ |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]ethylazanium |
| SMILES | Cc1ccc(NC(=O)N(CC[NH3+])c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H18FN3O/c1-12-2-6-14(7-3-12)19-16(21)20(11-10-18)15-8-4-13(17)5-9-15/h2-9H,10-11,18H2,1H3,(H,19,21)/p+1 |
| InChIKey | OTTWHLXCZQOFMK-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |