C26H36FN3O2 — CID 42726117
N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-3,5,5-trimethylhexanamide (PubChem CID 42726117) has the molecular formula C26H36FN3O2 and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 42726117 |
| Molecular Formula | C26H36FN3O2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-3,5,5-trimethylhexanamide |
| SMILES | Cc1ccc(NC(=O)N(CCCNC(=O)CC(C)CC(C)(C)C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H36FN3O2/c1-19-7-11-22(12-8-19)29-25(32)30(23-13-9-21(27)10-14-23)16-6-15-28-24(31)17-20(2)18-26(3,4)5/h7-14,20H,6,15-18H2,1-5H3,(H,28,31)(H,29,32) |
| InChIKey | VHOWRSANGOOMAU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|