C31H30FN3O2 — CID 42726048
N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-2,2-diphenylacetamide (PubChem CID 42726048) has the molecular formula C31H30FN3O2 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 42726048 |
| Molecular Formula | C31H30FN3O2 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]-2,2-diphenylacetamide |
| SMILES | Cc1ccc(NC(=O)N(CCCNC(=O)C(c2ccccc2)c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C31H30FN3O2/c1-23-13-17-27(18-14-23)34-31(37)35(28-19-15-26(32)16-20-28)22-8-21-33-30(36)29(24-9-4-2-5-10-24)25-11-6-3-7-12-25/h2-7,9-20,29H,8,21-22H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | PBHJMPGCBOAVDZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|