C29H27FN4O4 — CID 42726113
3-(2-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea (PubChem CID 42726113) has the molecular formula C29H27FN4O4 and a molecular weight of 514.56 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(2-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42726113 |
| Molecular Formula | C29H27FN4O4 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1-(4-phenoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCCN(C(=O)Nc2ccccc2F)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H27FN4O4/c1-37-23-15-11-21(12-16-23)32-28(35)31-19-20-34(29(36)33-27-10-6-5-9-26(27)30)22-13-17-25(18-14-22)38-24-7-3-2-4-8-24/h2-18H,19-20H2,1H3,(H,33,36)(H2,31,32,35) |
| InChIKey | NJILSXKFJGZPKK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |