C29H25F3N4O3 — CID 42708779
1-(4-phenoxyphenyl)-3-phenyl-1-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea (PubChem CID 42708779) has the molecular formula C29H25F3N4O3 and a molecular weight of 534.54 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-3-phenyl-1-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea.
| Compound Name | 1-(4-phenoxyphenyl)-3-phenyl-1-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea |
|---|---|
| PubChem CID | 42708779 |
| Molecular Formula | C29H25F3N4O3 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1-(4-phenoxyphenyl)-3-phenyl-1-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea |
| SMILES | O=C(NCCN(C(=O)Nc1ccccc1)c1ccc(Oc2ccccc2)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H25F3N4O3/c30-29(31,32)25-13-7-8-14-26(25)35-27(37)33-19-20-36(28(38)34-21-9-3-1-4-10-21)22-15-17-24(18-16-22)39-23-11-5-2-6-12-23/h1-18H,19-20H2,(H,34,38)(H2,33,35,37) |
| InChIKey | JYBXSVSQGMNUDH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |