C33H35N3O3 — CID 42726194
4-tert-butyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide (PubChem CID 42726194) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide |
|---|---|
| PubChem CID | 42726194 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 4-tert-butyl-N-[2-[N-[(4-methylphenyl)carbamoyl]-4-phenoxyanilino]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)N(CCNC(=O)c2ccc(C(C)(C)C)cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H35N3O3/c1-24-10-16-27(17-11-24)35-32(38)36(28-18-20-30(21-19-28)39-29-8-6-5-7-9-29)23-22-34-31(37)25-12-14-26(15-13-25)33(2,3)4/h5-21H,22-23H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | NRMIJFALDIGNMM-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |