C33H37N3O5S — CID 42707086
3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)-1-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]urea (PubChem CID 42707086) has the molecular formula C33H37N3O5S and a molecular weight of 587.74 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)-1-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]urea.
| Compound Name | 3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)-1-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]urea |
|---|---|
| PubChem CID | 42707086 |
| Molecular Formula | C33H37N3O5S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-(4-phenoxyphenyl)-1-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]urea |
| SMILES | CCOc1ccc(NC(=O)N(CCCNS(=O)(=O)c2c(C)cc(C)cc2C)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O5S/c1-5-40-29-16-12-27(13-17-29)35-33(37)36(28-14-18-31(19-15-28)41-30-10-7-6-8-11-30)21-9-20-34-42(38,39)32-25(3)22-24(2)23-26(32)4/h6-8,10-19,22-23,34H,5,9,20-21H2,1-4H3,(H,35,37) |
| InChIKey | CKESUWXPPUVSIW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|