C33H31N3O5S — CID 42707039
3-(2-methoxyphenyl)-1-[3-(naphthalen-2-ylsulfonylamino)propyl]-1-(4-phenoxyphenyl)urea (PubChem CID 42707039) has the molecular formula C33H31N3O5S and a molecular weight of 581.69 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[3-(naphthalen-2-ylsulfonylamino)propyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(2-methoxyphenyl)-1-[3-(naphthalen-2-ylsulfonylamino)propyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42707039 |
| Molecular Formula | C33H31N3O5S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[3-(naphthalen-2-ylsulfonylamino)propyl]-1-(4-phenoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)N(CCCNS(=O)(=O)c1ccc2ccccc2c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H31N3O5S/c1-40-32-15-8-7-14-31(32)35-33(37)36(27-17-19-29(20-18-27)41-28-12-3-2-4-13-28)23-9-22-34-42(38,39)30-21-16-25-10-5-6-11-26(25)24-30/h2-8,10-21,24,34H,9,22-23H2,1H3,(H,35,37) |
| InChIKey | RABGQDDDDZNYSZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|