C32H31N3O4 — CID 42707034
(E)-N-[3-[N-[(2-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]-3-phenylprop-2-enamide (PubChem CID 42707034) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is (E)-N-[3-[N-[(2-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[N-[(2-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42707034 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (E)-N-[3-[N-[(2-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccccc1NC(=O)N(CCCNC(=O)/C=C/c1ccccc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N3O4/c1-38-30-16-9-8-15-29(30)34-32(37)35(24-10-23-33-31(36)22-17-25-11-4-2-5-12-25)26-18-20-28(21-19-26)39-27-13-6-3-7-14-27/h2-9,11-22H,10,23-24H2,1H3,(H,33,36)(H,34,37)/b22-17+ |
| InChIKey | CJTXUDASNXBDCP-OQKWZONESA-N |
| XLogP | 6.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|