C26H24Cl2N4O5 — CID 42708736
(E)-N-[3-[N-[(3,4-dichlorophenyl)carbamoyl]-4-methoxyanilino]propyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 42708736) has the molecular formula C26H24Cl2N4O5 and a molecular weight of 543.41 g/mol. Its IUPAC name is (E)-N-[3-[N-[(3,4-dichlorophenyl)carbamoyl]-4-methoxyanilino]propyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[N-[(3,4-dichlorophenyl)carbamoyl]-4-methoxyanilino]propyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42708736 |
| Molecular Formula | C26H24Cl2N4O5 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (E)-N-[3-[N-[(3,4-dichlorophenyl)carbamoyl]-4-methoxyanilino]propyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(N(CCCNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H24Cl2N4O5/c1-37-22-11-9-20(10-12-22)31(26(34)30-19-6-13-23(27)24(28)17-19)16-2-15-29-25(33)14-5-18-3-7-21(8-4-18)32(35)36/h3-14,17H,2,15-16H2,1H3,(H,29,33)(H,30,34)/b14-5+ |
| InChIKey | FBKSRZWNDMWQNQ-LHHJGKSTSA-N |
| XLogP | 6.17 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|