C12H14N2O3 — CID 6259038
(E)-3-(4-nitrophenyl)-N-propylprop-2-enamide (PubChem CID 6259038) has the molecular formula C12H14N2O3 and a molecular weight of 234.26 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-propylprop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 6259038 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-9-13-12(15)8-5-10-3-6-11(7-4-10)14(16)17/h3-8H,2,9H2,1H3,(H,13,15)/b8-5+ |
| InChIKey | GHYKZGICYMRAGB-VMPITWQZSA-N |
| XLogP | 2.13 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|