C25H25F3N4O3 — CID 42705271
3-(2-methoxyphenyl)-1-phenyl-1-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea (PubChem CID 42705271) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-phenyl-1-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea.
| Compound Name | 3-(2-methoxyphenyl)-1-phenyl-1-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
|---|---|
| PubChem CID | 42705271 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-phenyl-1-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]propyl]urea |
| SMILES | COc1ccccc1NC(=O)N(CCCNC(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C25H25F3N4O3/c1-35-22-14-6-5-13-21(22)31-24(34)32(20-11-3-2-4-12-20)16-8-15-29-23(33)30-19-10-7-9-18(17-19)25(26,27)28/h2-7,9-14,17H,8,15-16H2,1H3,(H,31,34)(H2,29,30,33) |
| InChIKey | YUWHROUTTBDVAA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|