C23H21ClFN3O2 — CID 42705306
4-chloro-N-[3-[(2-fluorophenyl)carbamoylamino]propyl]-N-phenylbenzamide (PubChem CID 42705306) has the molecular formula C23H21ClFN3O2 and a molecular weight of 425.89 g/mol. Its IUPAC name is 4-chloro-N-[3-[(2-fluorophenyl)carbamoylamino]propyl]-N-phenylbenzamide.
| Compound Name | 4-chloro-N-[3-[(2-fluorophenyl)carbamoylamino]propyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42705306 |
| Molecular Formula | C23H21ClFN3O2 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-chloro-N-[3-[(2-fluorophenyl)carbamoylamino]propyl]-N-phenylbenzamide |
| SMILES | O=C(NCCCN(C(=O)c1ccc(Cl)cc1)c1ccccc1)Nc1ccccc1F |
| InChI | InChI=1S/C23H21ClFN3O2/c24-18-13-11-17(12-14-18)22(29)28(19-7-2-1-3-8-19)16-6-15-26-23(30)27-21-10-5-4-9-20(21)25/h1-5,7-14H,6,15-16H2,(H2,26,27,30) |
| InChIKey | ONYCVWAIXWTQCK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|