C21H25Cl2FN4O2 — CID 42704685
1-[3-(butylcarbamoylamino)propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea (PubChem CID 42704685) has the molecular formula C21H25Cl2FN4O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is 1-[3-(butylcarbamoylamino)propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea.
| Compound Name | 1-[3-(butylcarbamoylamino)propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42704685 |
| Molecular Formula | C21H25Cl2FN4O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[3-(butylcarbamoylamino)propyl]-3-(3,4-dichlorophenyl)-1-(4-fluorophenyl)urea |
| SMILES | CCCCNC(=O)NCCCN(C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25Cl2FN4O2/c1-2-3-11-25-20(29)26-12-4-13-28(17-8-5-15(24)6-9-17)21(30)27-16-7-10-18(22)19(23)14-16/h5-10,14H,2-4,11-13H2,1H3,(H,27,30)(H2,25,26,29) |
| InChIKey | YDOBJNBLOWJPCV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|