C23H19ClF3N3O2 — CID 42702821
4-chloro-N-[2-[N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide (PubChem CID 42702821) has the molecular formula C23H19ClF3N3O2 and a molecular weight of 461.87 g/mol. Its IUPAC name is 4-chloro-N-[2-[N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 42702821 |
| Molecular Formula | C23H19ClF3N3O2 |
| Molecular Weight | 461.87 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-chloro-N-[2-[N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide |
| SMILES | O=C(NCCN(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClF3N3O2/c24-18-11-9-16(10-12-18)21(31)28-13-14-30(20-7-2-1-3-8-20)22(32)29-19-6-4-5-17(15-19)23(25,26)27/h1-12,15H,13-14H2,(H,28,31)(H,29,32) |
| InChIKey | CAJNRVJQJDLRGD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |