C24H22F4N4O2 — CID 42706874
1-[2-(benzylcarbamoylamino)ethyl]-1-(4-fluorophenyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42706874) has the molecular formula C24H22F4N4O2 and a molecular weight of 474.46 g/mol. Its IUPAC name is 1-[2-(benzylcarbamoylamino)ethyl]-1-(4-fluorophenyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(benzylcarbamoylamino)ethyl]-1-(4-fluorophenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42706874 |
| Molecular Formula | C24H22F4N4O2 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[2-(benzylcarbamoylamino)ethyl]-1-(4-fluorophenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCN(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(F)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C24H22F4N4O2/c25-19-9-11-21(12-10-19)32(14-13-29-22(33)30-16-17-5-2-1-3-6-17)23(34)31-20-8-4-7-18(15-20)24(26,27)28/h1-12,15H,13-14,16H2,(H,31,34)(H2,29,30,33) |
| InChIKey | FHKMKKFPVQEBSP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |