C24H21F4N3O3 — CID 3919303
N-[2-[4-fluoro-N-[(3-methoxyphenyl)carbamoyl]anilino]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 3919303) has the molecular formula C24H21F4N3O3 and a molecular weight of 475.44 g/mol. Its IUPAC name is N-[2-[4-fluoro-N-[(3-methoxyphenyl)carbamoyl]anilino]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-fluoro-N-[(3-methoxyphenyl)carbamoyl]anilino]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3919303 |
| Molecular Formula | C24H21F4N3O3 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[2-[4-fluoro-N-[(3-methoxyphenyl)carbamoyl]anilino]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1cccc(NC(=O)N(CCNC(=O)c2cccc(C(F)(F)F)c2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H21F4N3O3/c1-34-21-7-3-6-19(15-21)30-23(33)31(20-10-8-18(25)9-11-20)13-12-29-22(32)16-4-2-5-17(14-16)24(26,27)28/h2-11,14-15H,12-13H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | ULYNLKRSNXCWJK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |