C24H23FN4O4 — CID 42705325
N-[3-[4-fluoro-N-[(3-methylphenyl)carbamoyl]anilino]propyl]-3-nitrobenzamide (PubChem CID 42705325) has the molecular formula C24H23FN4O4 and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[3-[4-fluoro-N-[(3-methylphenyl)carbamoyl]anilino]propyl]-3-nitrobenzamide.
| Compound Name | N-[3-[4-fluoro-N-[(3-methylphenyl)carbamoyl]anilino]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42705325 |
| Molecular Formula | C24H23FN4O4 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[3-[4-fluoro-N-[(3-methylphenyl)carbamoyl]anilino]propyl]-3-nitrobenzamide |
| SMILES | Cc1cccc(NC(=O)N(CCCNC(=O)c2cccc([N+](=O)[O-])c2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H23FN4O4/c1-17-5-2-7-20(15-17)27-24(31)28(21-11-9-19(25)10-12-21)14-4-13-26-23(30)18-6-3-8-22(16-18)29(32)33/h2-3,5-12,15-16H,4,13-14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | PPBLYXPUDYDEFC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|