C23H19Cl3F3N3O3S — CID 42657196
3-(3-chlorophenyl)-1-[3-[(2,5-dichlorophenyl)sulfonylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42657196) has the molecular formula C23H19Cl3F3N3O3S and a molecular weight of 580.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-[(2,5-dichlorophenyl)sulfonylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-[(2,5-dichlorophenyl)sulfonylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42657196 |
| Molecular Formula | C23H19Cl3F3N3O3S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 579.02 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-[(2,5-dichlorophenyl)sulfonylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N(CCCNS(=O)(=O)c1cc(Cl)ccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19Cl3F3N3O3S/c24-16-5-2-6-18(13-16)31-22(33)32(19-7-1-4-15(12-19)23(27,28)29)11-3-10-30-36(34,35)21-14-17(25)8-9-20(21)26/h1-2,4-9,12-14,30H,3,10-11H2,(H,31,33) |
| InChIKey | CKUSQPLMUQOFOU-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|