C30H33FN2O3S — CID 141387307
4-tert-butyl-N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)pyrrol-1-yl]butyl]benzenesulfonamide (PubChem CID 141387307) has the molecular formula C30H33FN2O3S and a molecular weight of 520.67 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)pyrrol-1-yl]butyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)pyrrol-1-yl]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141387307 |
| Molecular Formula | C30H33FN2O3S |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-tert-butyl-N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)pyrrol-1-yl]butyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCCCn2cc(-c3ccc(O)cc3)c(-c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C30H33FN2O3S/c1-30(2,3)24-10-16-27(17-11-24)37(35,36)32-18-4-5-19-33-20-28(22-6-12-25(31)13-7-22)29(21-33)23-8-14-26(34)15-9-23/h6-17,20-21,32,34H,4-5,18-19H2,1-3H3 |
| InChIKey | RZJFHPJHMQBDRR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|