C27H22F4N2O6S — CID 127025832
N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2,5-dioxopyrrol-1-yl]butyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 127025832) has the molecular formula C27H22F4N2O6S and a molecular weight of 578.54 g/mol. Its IUPAC name is N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2,5-dioxopyrrol-1-yl]butyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2,5-dioxopyrrol-1-yl]butyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 127025832 |
| Molecular Formula | C27H22F4N2O6S |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | N-[4-[3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2,5-dioxopyrrol-1-yl]butyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=C1C(c2ccc(O)cc2)=C(c2ccc(F)cc2)C(=O)N1CCCCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22F4N2O6S/c28-19-7-3-17(4-8-19)23-24(18-5-9-20(34)10-6-18)26(36)33(25(23)35)16-2-1-15-32-40(37,38)22-13-11-21(12-14-22)39-27(29,30)31/h3-14,32,34H,1-2,15-16H2 |
| InChIKey | IOLFFXZYTGIXAR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|