C26H29Cl2N3O — CID 22506194
1-[3-[bis[2-(4-chlorophenyl)ethyl]amino]propyl]-3-phenylurea (PubChem CID 22506194) has the molecular formula C26H29Cl2N3O and a molecular weight of 470.44 g/mol. Its IUPAC name is 1-[3-[bis[2-(4-chlorophenyl)ethyl]amino]propyl]-3-phenylurea.
| Compound Name | 1-[3-[bis[2-(4-chlorophenyl)ethyl]amino]propyl]-3-phenylurea |
|---|---|
| PubChem CID | 22506194 |
| Molecular Formula | C26H29Cl2N3O |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-[3-[bis[2-(4-chlorophenyl)ethyl]amino]propyl]-3-phenylurea |
| SMILES | O=C(NCCCN(CCc1ccc(Cl)cc1)CCc1ccc(Cl)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C26H29Cl2N3O/c27-23-11-7-21(8-12-23)15-19-31(20-16-22-9-13-24(28)14-10-22)18-4-17-29-26(32)30-25-5-2-1-3-6-25/h1-3,5-14H,4,15-20H2,(H2,29,30,32) |
| InChIKey | GAILHOGACDKLIN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|