C25H24F3N5O4 — CID 3720684
1-[2-[(2,6-dimethylphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 3720684) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is 1-[2-[(2,6-dimethylphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[(2,6-dimethylphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3720684 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-[2-[(2,6-dimethylphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3N5O4/c1-16-5-3-6-17(2)22(16)31-23(34)29-13-14-32(21-8-4-7-18(15-21)25(26,27)28)24(35)30-19-9-11-20(12-10-19)33(36)37/h3-12,15H,13-14H2,1-2H3,(H,30,35)(H2,29,31,34) |
| InChIKey | HUVCHOMZFAYONM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|