C24H26N2O9S — CID 66574321
(4-nitrophenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate (PubChem CID 66574321) has the molecular formula C24H26N2O9S and a molecular weight of 518.54 g/mol. Its IUPAC name is (4-nitrophenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate.
| Compound Name | (4-nitrophenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate |
|---|---|
| PubChem CID | 66574321 |
| Molecular Formula | C24H26N2O9S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (4-nitrophenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O9S/c1-31-21-9-5-17(23(13-21)33-3)15-25(16-18-6-10-22(32-2)14-24(18)34-4)36(29,30)35-20-11-7-19(8-12-20)26(27)28/h5-14H,15-16H2,1-4H3 |
| InChIKey | XEKCALSHSMSYBL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|