C22H22BrNO5S — CID 66573570
(4-bromophenyl) N-benzyl-N-[(2,4-dimethoxyphenyl)methyl]sulfamate (PubChem CID 66573570) has the molecular formula C22H22BrNO5S and a molecular weight of 492.39 g/mol. Its IUPAC name is (4-bromophenyl) N-benzyl-N-[(2,4-dimethoxyphenyl)methyl]sulfamate.
| Compound Name | (4-bromophenyl) N-benzyl-N-[(2,4-dimethoxyphenyl)methyl]sulfamate |
|---|---|
| PubChem CID | 66573570 |
| Molecular Formula | C22H22BrNO5S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | (4-bromophenyl) N-benzyl-N-[(2,4-dimethoxyphenyl)methyl]sulfamate |
| SMILES | COc1ccc(CN(Cc2ccccc2)S(=O)(=O)Oc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H22BrNO5S/c1-27-21-11-8-18(22(14-21)28-2)16-24(15-17-6-4-3-5-7-17)30(25,26)29-20-12-9-19(23)10-13-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | OYEVVAQIIDUSMH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |