C18H24N2O2 — CID 39423483
N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 39423483) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 39423483 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | COc1ccc(CN(CCN)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-21-17-9-8-16(18(12-17)22-2)14-20(11-10-19)13-15-6-4-3-5-7-15/h3-9,12H,10-11,13-14,19H2,1-2H3 |
| InChIKey | LMOOMGSUIREXDH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |