C17H22N2O3 — CID 111116702
2-[(2,4-dimethoxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethanol (PubChem CID 111116702) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethanol.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 111116702 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl-(pyridin-2-ylmethyl)amino]ethanol |
| SMILES | COc1ccc(CN(CCO)Cc2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O3/c1-21-16-7-6-14(17(11-16)22-2)12-19(9-10-20)13-15-5-3-4-8-18-15/h3-8,11,20H,9-10,12-13H2,1-2H3 |
| InChIKey | NSSXQJDNGTXHTI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |