C17H21ClN2O3 — CID 111113631
2-[(2-chloro-3-pyridinyl)methyl-[(2,5-dimethoxyphenyl)methyl]amino]ethanol (PubChem CID 111113631) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)methyl-[(2,5-dimethoxyphenyl)methyl]amino]ethanol.
| Compound Name | 2-[(2-chloro-3-pyridinyl)methyl-[(2,5-dimethoxyphenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 111113631 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)methyl-[(2,5-dimethoxyphenyl)methyl]amino]ethanol |
| SMILES | COc1ccc(OC)c(CN(CCO)Cc2cccnc2Cl)c1 |
| InChI | InChI=1S/C17H21ClN2O3/c1-22-15-5-6-16(23-2)14(10-15)12-20(8-9-21)11-13-4-3-7-19-17(13)18/h3-7,10,21H,8-9,11-12H2,1-2H3 |
| InChIKey | PEYLSMSWVUDYBA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|