C12H18BrNO3 — CID 30983525
2-[(5-bromo-2-methoxyphenyl)methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 30983525) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 30983525 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | COc1ccc(Br)cc1CN(CCO)CCO |
| InChI | InChI=1S/C12H18BrNO3/c1-17-12-3-2-11(13)8-10(12)9-14(4-6-15)5-7-16/h2-3,8,15-16H,4-7,9H2,1H3 |
| InChIKey | YSPWBQRJNURBAT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |