C10H13BrO3 — CID 162503231
2-[(5-bromo-2-methoxyphenyl)methoxy]ethanol (PubChem CID 162503231) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methoxy]ethanol.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methoxy]ethanol |
|---|---|
| PubChem CID | 162503231 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methoxy]ethanol |
| SMILES | COc1ccc(Br)cc1COCCO |
| InChI | InChI=1S/C10H13BrO3/c1-13-10-3-2-9(11)6-8(10)7-14-5-4-12/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | STXBHJWGPMWXBY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|