C13H17BrO2 — CID 79112669
4-bromo-1-methoxy-2-(pent-4-enoxymethyl)benzene (PubChem CID 79112669) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 4-bromo-1-methoxy-2-(pent-4-enoxymethyl)benzene.
| Compound Name | 4-bromo-1-methoxy-2-(pent-4-enoxymethyl)benzene |
|---|---|
| PubChem CID | 79112669 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-bromo-1-methoxy-2-(pent-4-enoxymethyl)benzene |
| SMILES | C=CCCCOCc1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H17BrO2/c1-3-4-5-8-16-10-11-9-12(14)6-7-13(11)15-2/h3,6-7,9H,1,4-5,8,10H2,2H3 |
| InChIKey | CKBOJIFJBIAICV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|