C13H16O3 — CID 62031393
3-(but-3-enoxymethyl)-4-methoxybenzaldehyde (PubChem CID 62031393) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(but-3-enoxymethyl)-4-methoxybenzaldehyde.
| Compound Name | 3-(but-3-enoxymethyl)-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 62031393 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-(but-3-enoxymethyl)-4-methoxybenzaldehyde |
| SMILES | C=CCCOCc1cc(C=O)ccc1OC |
| InChI | InChI=1S/C13H16O3/c1-3-4-7-16-10-12-8-11(9-14)5-6-13(12)15-2/h3,5-6,8-9H,1,4,7,10H2,2H3 |
| InChIKey | RRGRYACVHBSWAY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|