C12H10F6O3 — CID 102722538
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-methoxybenzaldehyde (PubChem CID 102722538) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-methoxybenzaldehyde.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 102722538 |
| Molecular Formula | C12H10F6O3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O3/c1-20-9-3-2-7(5-19)4-8(9)6-21-10(11(13,14)15)12(16,17)18/h2-5,10H,6H2,1H3 |
| InChIKey | ICLUAYDMBJNCCP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|